C11H11NO2 — CID 139502379
7-ethyl-2,3-dihydro-1,4-benzodioxine-5-carbonitrile (PubChem CID 139502379) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 7-ethyl-2,3-dihydro-1,4-benzodioxine-5-carbonitrile.
| Compound Name | 7-ethyl-2,3-dihydro-1,4-benzodioxine-5-carbonitrile |
|---|---|
| PubChem CID | 139502379 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 7-ethyl-2,3-dihydro-1,4-benzodioxine-5-carbonitrile |
| SMILES | CCc1cc(C#N)c2c(c1)OCCO2 |
| InChI | InChI=1S/C11H11NO2/c1-2-8-5-9(7-12)11-10(6-8)13-3-4-14-11/h5-6H,2-4H2,1H3 |
| InChIKey | GNWSUPDSECRYRL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |