C27H25ClN2O6S — CID 139504880
(3R,3aR,6R,6aR)-3-[[6-chloro-5-[4-(4-methylsulfonylphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-ol (PubChem CID 139504880) has the molecular formula C27H25ClN2O6S and a molecular weight of 541.03 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3-[[6-chloro-5-[4-(4-methylsulfonylphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-ol.
| Compound Name | (3R,3aR,6R,6aR)-3-[[6-chloro-5-[4-(4-methylsulfonylphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 139504880 |
| Molecular Formula | C27H25ClN2O6S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | (3R,3aR,6R,6aR)-3-[[6-chloro-5-[4-(4-methylsulfonylphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-ol |
| SMILES | C[C@]12OC[C@@H](Oc3nc4cc(-c5ccc(-c6ccc(S(C)(=O)=O)cc6)cc5)c(Cl)cc4[nH]3)[C@H]1OC[C@H]2O |
| InChI | InChI=1S/C27H25ClN2O6S/c1-27-24(31)14-34-25(27)23(13-35-27)36-26-29-21-11-19(20(28)12-22(21)30-26)17-5-3-15(4-6-17)16-7-9-18(10-8-16)37(2,32)33/h3-12,23-25,31H,13-14H2,1-2H3,(H,29,30)/t23-,24-,25-,27-/m1/s1 |
| InChIKey | ORFOUFIVOZSHTH-DLGLWYJGSA-N |
| XLogP | 4.25 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |