C29H25ClN2O5 — CID 139504944
2-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 139504944) has the molecular formula C29H25ClN2O5 and a molecular weight of 516.98 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 139504944 |
| Molecular Formula | C29H25ClN2O5 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1c1ccc(-c2ccc(-c3cc4nc(OC5CO[C@@H]6CCO[C@H]56)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C29H25ClN2O5/c30-22-13-24-23(31-29(32-24)37-26-14-36-25-9-10-35-27(25)26)12-20(22)18-7-3-16(4-8-18)15-1-5-17(6-2-15)19-11-21(19)28(33)34/h1-8,12-13,19,21,25-27H,9-11,14H2,(H,31,32)(H,33,34)/t19?,21?,25-,26?,27+/m1/s1 |
| InChIKey | QWECGNFXWPWLRR-RSNQGTBFSA-N |
| XLogP | 5.67 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |