C17H15ClN4O3 — CID 90067478
2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-pyridin-4-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 90067478) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-pyridin-4-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-pyridin-4-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 90067478 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-pyridin-4-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(O[C@@H]3CO[C@@H]4CCO[C@@H]43)nc2nc1-c1ccncc1 |
| InChI | InChI=1S/C17H15ClN4O3/c18-10-7-11-16(21-14(10)9-1-4-19-5-2-9)22-17(20-11)25-13-8-24-12-3-6-23-15(12)13/h1-2,4-5,7,12-13,15H,3,6,8H2,(H,20,21,22)/t12-,13-,15+/m1/s1 |
| InChIKey | HMQDCUIXGILVFS-NFAWXSAZSA-N |
| XLogP | 2.61 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |