C27H23ClN4O4 — CID 123216889
6-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 123216889) has the molecular formula C27H23ClN4O4 and a molecular weight of 502.96 g/mol. Its IUPAC name is 6-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 123216889 |
| Molecular Formula | C27H23ClN4O4 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 6-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2cc(-c3ccc(-c4nc5nc(OC6COC7CCOC76)[nH]c5cc4Cl)cc3)ccc21 |
| InChI | InChI=1S/C27H23ClN4O4/c28-19-12-20-25(32-27(30-20)36-22-13-35-21-8-10-34-24(21)22)31-23(19)15-3-1-14(2-4-15)16-5-6-18-17(11-16)7-9-29-26(18)33/h1-6,11-12,21-22,24H,7-10,13H2,(H,29,33)(H,30,31,32) |
| InChIKey | FSORLHYMQGVZMB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |