C24H19ClFN3O3 — CID 123868371
2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-5-[4-(3-fluorophenyl)phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 123868371) has the molecular formula C24H19ClFN3O3 and a molecular weight of 451.89 g/mol. Its IUPAC name is 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-5-[4-(3-fluorophenyl)phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-5-[4-(3-fluorophenyl)phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 123868371 |
| Molecular Formula | C24H19ClFN3O3 |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-5-[4-(3-fluorophenyl)phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Fc1cccc(-c2ccc(-c3nc4nc(OC5COC6CCOC65)[nH]c4cc3Cl)cc2)c1 |
| InChI | InChI=1S/C24H19ClFN3O3/c25-17-11-18-23(29-24(27-18)32-20-12-31-19-8-9-30-22(19)20)28-21(17)14-6-4-13(5-7-14)15-2-1-3-16(26)10-15/h1-7,10-11,19-20,22H,8-9,12H2,(H,27,28,29) |
| InChIKey | ZIYZAHCJIDZMGG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |