C22H17ClF3N5O3 — CID 138508701
2-[[(3aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 138508701) has the molecular formula C22H17ClF3N5O3 and a molecular weight of 491.86 g/mol. Its IUPAC name is 2-[[(3aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138508701 |
| Molecular Formula | C22H17ClF3N5O3 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-[[(3aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3nc4nc(OC5CO[C@@H]6CCOC56)[nH]c4cc3Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C22H17ClF3N5O3/c23-12-7-14-20(29-21(27-14)34-16-9-33-15-5-6-32-19(15)16)28-18(12)11-3-1-10(2-4-11)13-8-17(31-30-13)22(24,25)26/h1-4,7-8,15-16,19H,5-6,9H2,(H,30,31)(H,27,28,29)/t15-,16?,19?/m1/s1 |
| InChIKey | OCRDLTDZNJTYCP-MDCZIUGASA-N |
| XLogP | 4.62 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |