C15H14ClN5O3 — CID 138508895
2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(1H-pyrazol-5-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 138508895) has the molecular formula C15H14ClN5O3 and a molecular weight of 347.76 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(1H-pyrazol-5-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(1H-pyrazol-5-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138508895 |
| Molecular Formula | C15H14ClN5O3 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-(1H-pyrazol-5-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(OC3CO[C@@H]4CCO[C@H]34)nc2nc1-c1ccn[nH]1 |
| InChI | InChI=1S/C15H14ClN5O3/c16-7-5-9-14(19-12(7)8-1-3-17-21-8)20-15(18-9)24-11-6-23-10-2-4-22-13(10)11/h1,3,5,10-11,13H,2,4,6H2,(H,17,21)(H,18,19,20)/t10-,11?,13+/m1/s1 |
| InChIKey | MDQFSINVIQUMHT-XEEJXUNPSA-N |
| XLogP | 1.94 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |