C29H28ClN3O4 — CID 138508909
2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-4-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 138508909) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-4-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-4-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138508909 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-4-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(OC3CO[C@@H]4CCO[C@H]34)nc2nc1-c1ccc(-c2ccc(C3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H28ClN3O4/c30-22-15-23-28(33-29(31-23)37-25-16-36-24-11-14-35-27(24)25)32-26(22)21-7-5-18(6-8-21)17-1-3-19(4-2-17)20-9-12-34-13-10-20/h1-8,15,20,24-25,27H,9-14,16H2,(H,31,32,33)/t24-,25?,27+/m1/s1 |
| InChIKey | YEJYAWAEQXHFCS-LODWVWCYSA-N |
| XLogP | 5.77 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |