C28H26ClN3O5 — CID 138508786
4-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid (PubChem CID 138508786) has the molecular formula C28H26ClN3O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is 4-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 138508786 |
| Molecular Formula | C28H26ClN3O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-[4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-c2ccc(-c3nc4nc(OC5CO[C@@H]6CCO[C@H]56)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26ClN3O5/c29-20-14-21-27(32-28(30-21)37-23-15-36-22-12-13-35-26(22)23)31-25(20)19-10-8-18(9-11-19)17-6-4-16(5-7-17)2-1-3-24(33)34/h4-11,14,22-23,26H,1-3,12-13,15H2,(H,33,34)(H,30,31,32)/t22-,23?,26+/m1/s1 |
| InChIKey | HRHMETVOAYGRCE-SATOSQONSA-N |
| XLogP | 5.29 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |