C29H29ClN4O5S — CID 138508776
2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(4-piperidin-4-ylsulfonylphenyl)phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 138508776) has the molecular formula C29H29ClN4O5S and a molecular weight of 581.09 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(4-piperidin-4-ylsulfonylphenyl)phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(4-piperidin-4-ylsulfonylphenyl)phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138508776 |
| Molecular Formula | C29H29ClN4O5S |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(4-piperidin-4-ylsulfonylphenyl)phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | O=S(=O)(c1ccc(-c2ccc(-c3nc4nc(OC5CO[C@@H]6CCO[C@H]56)[nH]c4cc3Cl)cc2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C29H29ClN4O5S/c30-22-15-23-28(34-29(32-23)39-25-16-38-24-11-14-37-27(24)25)33-26(22)19-3-1-17(2-4-19)18-5-7-20(8-6-18)40(35,36)21-9-12-31-13-10-21/h1-8,15,21,24-25,27,31H,9-14,16H2,(H,32,33,34)/t24-,25?,27+/m1/s1 |
| InChIKey | BMQQSIOGTKXCGE-LODWVWCYSA-N |
| XLogP | 4.41 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |