C21H22ClN5O4 — CID 138508961
1-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3-ethylurea (PubChem CID 138508961) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is 1-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 138508961 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(-c2nc3nc(OC4CO[C@@H]5CCO[C@H]45)[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C21H22ClN5O4/c1-2-23-20(28)24-12-5-3-11(4-6-12)17-13(22)9-14-19(26-17)27-21(25-14)31-16-10-30-15-7-8-29-18(15)16/h3-6,9,15-16,18H,2,7-8,10H2,1H3,(H2,23,24,28)(H,25,26,27)/t15-,16?,18+/m1/s1 |
| InChIKey | CDKYPJJWDLOOCP-AGPBCMBSSA-N |
| XLogP | 3.35 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |