C24H27ClN4O5 — CID 123839699
4-[2-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenoxy]ethyl]morpholine (PubChem CID 123839699) has the molecular formula C24H27ClN4O5 and a molecular weight of 486.96 g/mol. Its IUPAC name is 4-[2-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 123839699 |
| Molecular Formula | C24H27ClN4O5 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-[2-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenoxy]ethyl]morpholine |
| SMILES | Clc1cc2[nH]c(OC3COC4CCOC43)nc2nc1-c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27ClN4O5/c25-17-13-18-23(28-24(26-18)34-20-14-33-19-5-9-32-22(19)20)27-21(17)15-1-3-16(4-2-15)31-12-8-29-6-10-30-11-7-29/h1-4,13,19-20,22H,5-12,14H2,(H,26,27,28) |
| InChIKey | GZLMEIYJJLKMHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |