C23H22ClN5O4 — CID 138508973
2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(2-imidazol-1-ylethoxy)phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 138508973) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(2-imidazol-1-ylethoxy)phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(2-imidazol-1-ylethoxy)phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138508973 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-(2-imidazol-1-ylethoxy)phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(OC3CO[C@@H]4CCO[C@H]34)nc2nc1-c1ccc(OCCn2ccnc2)cc1 |
| InChI | InChI=1S/C23H22ClN5O4/c24-16-11-17-22(28-23(26-17)33-19-12-32-18-5-9-31-21(18)19)27-20(16)14-1-3-15(4-2-14)30-10-8-29-7-6-25-13-29/h1-4,6-7,11,13,18-19,21H,5,8-10,12H2,(H,26,27,28)/t18-,19?,21+/m1/s1 |
| InChIKey | HLKCJHKUJMAAKH-DRPMKMPGSA-N |
| XLogP | 3.49 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |