C31H31ClN2O4 — CID 157387506
2-[[(3R,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-2-yl)phenyl]phenyl]-1H-benzimidazole (PubChem CID 157387506) has the molecular formula C31H31ClN2O4 and a molecular weight of 531.05 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-2-yl)phenyl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[[(3R,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-2-yl)phenyl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 157387506 |
| Molecular Formula | C31H31ClN2O4 |
| Molecular Weight | 531.05 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-5-[4-[4-(oxan-2-yl)phenyl]phenyl]-1H-benzimidazole |
| SMILES | C[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2cc(-c3ccc(-c4ccc(C5CCCCO5)cc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C31H31ClN2O4/c1-18-16-36-30-28(17-37-29(18)30)38-31-33-25-14-23(24(32)15-26(25)34-31)21-9-5-19(6-10-21)20-7-11-22(12-8-20)27-4-2-3-13-35-27/h5-12,14-15,18,27-30H,2-4,13,16-17H2,1H3,(H,33,34)/t18-,27?,28-,29-,30-/m1/s1 |
| InChIKey | LLDOQLNBIZGIPG-XBOVDTLBSA-N |
| XLogP | 6.97 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.05 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |