C28H26ClN3O4 — CID 144579622
4-[4-[2-[[(3aR,6aS)-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide (PubChem CID 144579622) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is 4-[4-[2-[[(3aR,6aS)-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide.
| Compound Name | 4-[4-[2-[[(3aR,6aS)-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 144579622 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[4-[2-[[(3aR,6aS)-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(-c3cc4nc(OC5CO[C@@H]6CCO[C@]56C)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26ClN3O4/c1-28-24(11-12-35-28)34-15-25(28)36-27-31-22-13-20(21(29)14-23(22)32-27)18-7-3-16(4-8-18)17-5-9-19(10-6-17)26(33)30-2/h3-10,13-14,24-25H,11-12,15H2,1-2H3,(H,30,33)(H,31,32)/t24-,25?,28+/m1/s1 |
| InChIKey | LFKWDGIYFPSGNQ-CTGOOGPZSA-N |
| XLogP | 5.24 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |