C23H17F3N4OS2 — CID 139506141
4-[N-methyl-4-(trifluoromethyl)anilino]sulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 139506141) has the molecular formula C23H17F3N4OS2 and a molecular weight of 486.54 g/mol. Its IUPAC name is 4-[N-methyl-4-(trifluoromethyl)anilino]sulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[N-methyl-4-(trifluoromethyl)anilino]sulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 139506141 |
| Molecular Formula | C23H17F3N4OS2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 4-[N-methyl-4-(trifluoromethyl)anilino]sulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CN(Sc1ccc(C(=O)Nc2nc(-c3ccccn3)cs2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N4OS2/c1-30(17-9-7-16(8-10-17)23(24,25)26)33-18-11-5-15(6-12-18)21(31)29-22-28-20(14-32-22)19-4-2-3-13-27-19/h2-14H,1H3,(H,28,29,31) |
| InChIKey | UVEJBTKAYJLSDK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|