C16H15N7OS — CID 176676300
4-[diazenyl(methanimidoyl)amino]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen (PubChem CID 176676300) has the molecular formula C16H15N7OS and a molecular weight of 353.41 g/mol. Its IUPAC name is 4-[diazenyl(methanimidoyl)amino]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen.
| Compound Name | 4-[diazenyl(methanimidoyl)amino]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 176676300 |
| Molecular Formula | C16H15N7OS |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[diazenyl(methanimidoyl)amino]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen |
| SMILES | [H]/N=C/N(/N=N/[H])c1ccc(C(=O)Nc2nc(-c3ccccn3)cs2)cc1.[H][H] |
| InChI | InChI=1S/C16H13N7OS.H2/c17-10-23(22-18)12-6-4-11(5-7-12)15(24)21-16-20-14(9-25-16)13-3-1-2-8-19-13;/h1-10,17-18H,(H,20,21,24);1H/b17-10+,22-18+; |
| InChIKey | CSXATUFTMLJEJW-JGRBRKIXSA-N |
| XLogP | 4.06 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|