C19H22N2O3 — CID 139512307
methyl 6-[7-(hydroxymethyl)-9H-pyrido[3,4-b]indol-1-yl]hexanoate (PubChem CID 139512307) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 6-[7-(hydroxymethyl)-9H-pyrido[3,4-b]indol-1-yl]hexanoate.
| Compound Name | methyl 6-[7-(hydroxymethyl)-9H-pyrido[3,4-b]indol-1-yl]hexanoate |
|---|---|
| PubChem CID | 139512307 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl 6-[7-(hydroxymethyl)-9H-pyrido[3,4-b]indol-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCc1nccc2c1[nH]c1cc(CO)ccc12 |
| InChI | InChI=1S/C19H22N2O3/c1-24-18(23)6-4-2-3-5-16-19-15(9-10-20-16)14-8-7-13(12-22)11-17(14)21-19/h7-11,21-22H,2-6,12H2,1H3 |
| InChIKey | ACBKKCMTZBMACB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|