C14H16O4 — CID 139514349
3-[[4-(furan-2-yl)phenyl]methoxy]propane-1,2-diol (PubChem CID 139514349) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[[4-(furan-2-yl)phenyl]methoxy]propane-1,2-diol.
| Compound Name | 3-[[4-(furan-2-yl)phenyl]methoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 139514349 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[[4-(furan-2-yl)phenyl]methoxy]propane-1,2-diol |
| SMILES | OCC(O)COCc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C14H16O4/c15-8-13(16)10-17-9-11-3-5-12(6-4-11)14-2-1-7-18-14/h1-7,13,15-16H,8-10H2 |
| InChIKey | BZIQLXIAGKUGTF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |