C19H12F4OS — CID 139515354
4-[3-fluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]benzenethiol (PubChem CID 139515354) has the molecular formula C19H12F4OS and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-[3-fluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]benzenethiol.
| Compound Name | 4-[3-fluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 139515354 |
| Molecular Formula | C19H12F4OS |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-[3-fluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]benzenethiol |
| SMILES | Fc1cc(-c2ccc(S)cc2)ccc1COc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H12F4OS/c20-16-7-12(11-3-5-15(25)6-4-11)1-2-13(16)10-24-14-8-17(21)19(23)18(22)9-14/h1-9,25H,10H2 |
| InChIKey | VJWHCSBYTHEHAV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|