C16H22S — CID 139515765
5-[(3E,5E)-6-ethylsulfanylhepta-1,3,5-trien-3-yl]-6-methylcyclohexa-1,3-diene (PubChem CID 139515765) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is 5-[(3E,5E)-6-ethylsulfanylhepta-1,3,5-trien-3-yl]-6-methylcyclohexa-1,3-diene.
| Compound Name | 5-[(3E,5E)-6-ethylsulfanylhepta-1,3,5-trien-3-yl]-6-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139515765 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-[(3E,5E)-6-ethylsulfanylhepta-1,3,5-trien-3-yl]-6-methylcyclohexa-1,3-diene |
| SMILES | C=C/C(=C\C=C(/C)SCC)C1C=CC=CC1C |
| InChI | InChI=1S/C16H22S/c1-5-15(12-11-14(4)17-6-2)16-10-8-7-9-13(16)3/h5,7-13,16H,1,6H2,2-4H3/b14-11+,15-12+ |
| InChIKey | PJFADYUSHJDTMV-LCPPQYOVSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|