C20H32O6 — CID 139515969
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-hydroxy-6-(6-oxabicyclo[3.1.1]heptan-2-ylmethoxy)hexanoate (PubChem CID 139515969) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-hydroxy-6-(6-oxabicyclo[3.1.1]heptan-2-ylmethoxy)hexanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-hydroxy-6-(6-oxabicyclo[3.1.1]heptan-2-ylmethoxy)hexanoate |
|---|---|
| PubChem CID | 139515969 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-hydroxy-6-(6-oxabicyclo[3.1.1]heptan-2-ylmethoxy)hexanoate |
| SMILES | O=C(CCCCC(O)OCC1CCC2CC1O2)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C20H32O6/c21-19(23-11-13-5-8-16-18(9-13)26-16)3-1-2-4-20(22)24-12-14-6-7-15-10-17(14)25-15/h13-18,20,22H,1-12H2 |
| InChIKey | ZJVTVWDGTBWRHC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|