C6H14N2O — CID 139517370
methyl (1Z)-N,2-dimethylpropanehydrazonate (PubChem CID 139517370) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is methyl (1Z)-N,2-dimethylpropanehydrazonate.
| Compound Name | methyl (1Z)-N,2-dimethylpropanehydrazonate |
|---|---|
| PubChem CID | 139517370 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | methyl (1Z)-N,2-dimethylpropanehydrazonate |
| SMILES | CN/N=C(\OC)C(C)C |
| InChI | InChI=1S/C6H14N2O/c1-5(2)6(9-4)8-7-3/h5,7H,1-4H3/b8-6- |
| InChIKey | GGGKQPXIMDKMHO-VURMDHGXSA-N |
| XLogP | 0.82 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|