About N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine
N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine (PubChem CID 158424207) has the molecular formula C8H19N3O
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine.
Molecular Properties
| Compound Name | N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine |
| PubChem CID | 158424207 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine |
| SMILES | CNN=C(C)C.CON=C(C)C |
| InChI | InChI=1S/C4H10N2.C4H9NO/c1-4(2)6-5-3;1-4(2)5-6-3/h5H,1-3H3;1-3H3 |
| InChIKey | HAVUNFRZDGOITB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine?
The IUPAC name of N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine (CID 158424207) is N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine.
What is the SMILES notation for N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine?
The canonical SMILES for N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine is CNN=C(C)C.CON=C(C)C.
What is the InChIKey of N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine?
The InChIKey is HAVUNFRZDGOITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C4H9NO/c1-4(2)6-5-3;1-4(2)5-6-3/h5H,1-3H3;1-3H3.
What are the key properties of N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine?
N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine has a molecular weight of 173.26 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxypropan-2-imine;N-(propan-2-ylideneamino)methanamine is sourced from PubChem (CID 158424207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).