C3H6F2N2O2 — CID 172962208
hydroxy (1Z)-2,2-difluoro-N-methylethanehydrazonate (PubChem CID 172962208) has the molecular formula C3H6F2N2O2 and a molecular weight of 140.09 g/mol. Its IUPAC name is hydroxy (1Z)-2,2-difluoro-N-methylethanehydrazonate.
| Compound Name | hydroxy (1Z)-2,2-difluoro-N-methylethanehydrazonate |
|---|---|
| PubChem CID | 172962208 |
| Molecular Formula | C3H6F2N2O2 |
| Molecular Weight | 140.09 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | hydroxy (1Z)-2,2-difluoro-N-methylethanehydrazonate |
| SMILES | CN/N=C(\OO)C(F)F |
| InChI | InChI=1S/C3H6F2N2O2/c1-6-7-3(9-8)2(4)5/h2,6,8H,1H3/b7-3- |
| InChIKey | FBIGNKVIOMTLRE-CLTKARDFSA-N |
| XLogP | 0.27 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.09 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|