C5H9F2N3 — CID 59444346
N-[(Z)-(4,4-difluoro-3-iminobutan-2-ylidene)amino]methanamine (PubChem CID 59444346) has the molecular formula C5H9F2N3 and a molecular weight of 149.14 g/mol. Its IUPAC name is N-[(Z)-(4,4-difluoro-3-iminobutan-2-ylidene)amino]methanamine.
| Compound Name | N-[(Z)-(4,4-difluoro-3-iminobutan-2-ylidene)amino]methanamine |
|---|---|
| PubChem CID | 59444346 |
| Molecular Formula | C5H9F2N3 |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-[(Z)-(4,4-difluoro-3-iminobutan-2-ylidene)amino]methanamine |
| SMILES | [H]/N=C(C(/C)=N\NC)\C(F)F |
| InChI | InChI=1S/C5H9F2N3/c1-3(10-9-2)4(8)5(6)7/h5,8-9H,1-2H3/b8-4-,10-3- |
| InChIKey | LTHJGTBSUUMCDO-CSNOKCSPSA-N |
| XLogP | 0.87 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|