C12H19Cl3N2O — CID 139519211
(2E,7Z)-N-(1-amino-2,2,2-trichloroethyl)-4-methylnona-2,7-dienamide (PubChem CID 139519211) has the molecular formula C12H19Cl3N2O and a molecular weight of 313.66 g/mol. Its IUPAC name is (2E,7Z)-N-(1-amino-2,2,2-trichloroethyl)-4-methylnona-2,7-dienamide.
| Compound Name | (2E,7Z)-N-(1-amino-2,2,2-trichloroethyl)-4-methylnona-2,7-dienamide |
|---|---|
| PubChem CID | 139519211 |
| Molecular Formula | C12H19Cl3N2O |
| Molecular Weight | 313.66 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2E,7Z)-N-(1-amino-2,2,2-trichloroethyl)-4-methylnona-2,7-dienamide |
| SMILES | C/C=C\CCC(C)/C=C/C(=O)NC(N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H19Cl3N2O/c1-3-4-5-6-9(2)7-8-10(18)17-11(16)12(13,14)15/h3-4,7-9,11H,5-6,16H2,1-2H3,(H,17,18)/b4-3-,8-7+ |
| InChIKey | FOGQCPNVRTYEQP-ODYTWBPASA-N |
| XLogP | 3.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|