C12H10ClFN2O3 — CID 139526277
N-(2-chloro-3-fluorophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 139526277) has the molecular formula C12H10ClFN2O3 and a molecular weight of 284.67 g/mol. Its IUPAC name is N-(2-chloro-3-fluorophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-(2-chloro-3-fluorophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 139526277 |
| Molecular Formula | C12H10ClFN2O3 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-(2-chloro-3-fluorophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CC1C(=O)NC(=O)C1C(=O)Nc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H10ClFN2O3/c1-5-8(12(19)16-10(5)17)11(18)15-7-4-2-3-6(14)9(7)13/h2-5,8H,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | XQKBPFSYZIMACK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|