C33H59N3O6 — CID 139527487
1-O-(5-ethyl-2,2,6-trimethylpiperidin-4-yl) 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate (PubChem CID 139527487) has the molecular formula C33H59N3O6 and a molecular weight of 593.85 g/mol. Its IUPAC name is 1-O-(5-ethyl-2,2,6-trimethylpiperidin-4-yl) 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate.
| Compound Name | 1-O-(5-ethyl-2,2,6-trimethylpiperidin-4-yl) 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139527487 |
| Molecular Formula | C33H59N3O6 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.44 |
| IUPAC Name | 1-O-(5-ethyl-2,2,6-trimethylpiperidin-4-yl) 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
| SMILES | CCC1C(C)NC(C)(C)CC1OC(=O)C(CC(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C33H59N3O6/c1-13-23-20(2)34-29(3,4)19-25(23)42-28(39)24(27(38)41-22-17-32(9,10)36-33(11,12)18-22)14-26(37)40-21-15-30(5,6)35-31(7,8)16-21/h20-25,34-36H,13-19H2,1-12H3 |
| InChIKey | UYKDWHXPZHZEIJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|