C19H24BrFN2O5 — CID 139530991
tert-butyl (4aR,8aR)-1-(4-bromo-5-fluoro-2-methoxyphenyl)-2-oxo-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazine-6-carboxylate (PubChem CID 139530991) has the molecular formula C19H24BrFN2O5 and a molecular weight of 459.31 g/mol. Its IUPAC name is tert-butyl (4aR,8aR)-1-(4-bromo-5-fluoro-2-methoxyphenyl)-2-oxo-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazine-6-carboxylate.
| Compound Name | tert-butyl (4aR,8aR)-1-(4-bromo-5-fluoro-2-methoxyphenyl)-2-oxo-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 139530991 |
| Molecular Formula | C19H24BrFN2O5 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | tert-butyl (4aR,8aR)-1-(4-bromo-5-fluoro-2-methoxyphenyl)-2-oxo-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazine-6-carboxylate |
| SMILES | COc1cc(Br)c(F)cc1N1C(=O)CO[C@@H]2CN(C(=O)OC(C)(C)C)CC[C@H]21 |
| InChI | InChI=1S/C19H24BrFN2O5/c1-19(2,3)28-18(25)22-6-5-13-16(9-22)27-10-17(24)23(13)14-8-12(21)11(20)7-15(14)26-4/h7-8,13,16H,5-6,9-10H2,1-4H3/t13-,16-/m1/s1 |
| InChIKey | FHOJQBINXAJBFB-CZUORRHYSA-N |
| XLogP | 3.34 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |