C18H19ClF3N3O4 — CID 139536253
methyl 2-(4-chlorophenyl)-2-[5-(dimethoxymethyl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]acetate (PubChem CID 139536253) has the molecular formula C18H19ClF3N3O4 and a molecular weight of 433.81 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-[5-(dimethoxymethyl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-[5-(dimethoxymethyl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 139536253 |
| Molecular Formula | C18H19ClF3N3O4 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-[5-(dimethoxymethyl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)c1nc(NCC(F)(F)F)ncc1C(OC)OC |
| InChI | InChI=1S/C18H19ClF3N3O4/c1-27-15(26)13(10-4-6-11(19)7-5-10)14-12(16(28-2)29-3)8-23-17(25-14)24-9-18(20,21)22/h4-8,13,16H,9H2,1-3H3,(H,23,24,25) |
| InChIKey | KXLUUVKZCUTEDT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|