C25H29FN2OS — CID 139542286
2-[4-[3-fluoro-4-[[(3S)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]acetonitrile (PubChem CID 139542286) has the molecular formula C25H29FN2OS and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-[[(3S)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]acetonitrile.
| Compound Name | 2-[4-[3-fluoro-4-[[(3S)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 139542286 |
| Molecular Formula | C25H29FN2OS |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[4-[3-fluoro-4-[[(3S)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]acetonitrile |
| SMILES | C[C@H]1CCC(c2ccccc2)SN1Cc1ccc(C2(CC#N)CCOCC2)cc1F |
| InChI | InChI=1S/C25H29FN2OS/c1-19-7-10-24(20-5-3-2-4-6-20)30-28(19)18-21-8-9-22(17-23(21)26)25(11-14-27)12-15-29-16-13-25/h2-6,8-9,17,19,24H,7,10-13,15-16,18H2,1H3/t19-,24?/m0/s1 |
| InChIKey | SKXHPMOYBCFVSS-XGLRFROISA-N |
| XLogP | 6.16 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|