C24H24FNO5S — CID 118225249
4-[3-fluoro-4-[(3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxane-4-carboxylic acid (PubChem CID 118225249) has the molecular formula C24H24FNO5S and a molecular weight of 457.52 g/mol. Its IUPAC name is 4-[3-fluoro-4-[(3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxane-4-carboxylic acid.
| Compound Name | 4-[3-fluoro-4-[(3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 118225249 |
| Molecular Formula | C24H24FNO5S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-[3-fluoro-4-[(3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxane-4-carboxylic acid |
| SMILES | CC1C(=O)C(=O)C(c2ccccc2)SN1Cc1ccc(C2(C(=O)O)CCOCC2)cc1F |
| InChI | InChI=1S/C24H24FNO5S/c1-15-20(27)21(28)22(16-5-3-2-4-6-16)32-26(15)14-17-7-8-18(13-19(17)25)24(23(29)30)9-11-31-12-10-24/h2-8,13,15,22H,9-12,14H2,1H3,(H,29,30) |
| InChIKey | QUFWCBPLNYWVCA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|