C26H32FN5S — CID 139528901
(3S,6S)-2-[[2-fluoro-4-[4-(3-methyl-1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane (PubChem CID 139528901) has the molecular formula C26H32FN5S and a molecular weight of 465.64 g/mol. Its IUPAC name is (3S,6S)-2-[[2-fluoro-4-[4-(3-methyl-1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane.
| Compound Name | (3S,6S)-2-[[2-fluoro-4-[4-(3-methyl-1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane |
|---|---|
| PubChem CID | 139528901 |
| Molecular Formula | C26H32FN5S |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (3S,6S)-2-[[2-fluoro-4-[4-(3-methyl-1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane |
| SMILES | Cc1nncn1C1CCN(c2ccc(CN3S[C@H](c4ccccc4)CC[C@@H]3C)c(F)c2)CC1 |
| InChI | InChI=1S/C26H32FN5S/c1-19-8-11-26(21-6-4-3-5-7-21)33-32(19)17-22-9-10-24(16-25(22)27)30-14-12-23(13-15-30)31-18-28-29-20(31)2/h3-7,9-10,16,18-19,23,26H,8,11-15,17H2,1-2H3/t19-,26-/m0/s1 |
| InChIKey | FQFFEHXUGFMEKA-SIBVEZHUSA-N |
| XLogP | 5.94 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|