C25H23F4N5S — CID 142733438
2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazine (PubChem CID 142733438) has the molecular formula C25H23F4N5S and a molecular weight of 501.55 g/mol. Its IUPAC name is 2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazine.
| Compound Name | 2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazine |
|---|---|
| PubChem CID | 142733438 |
| Molecular Formula | C25H23F4N5S |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazine |
| SMILES | Fc1cc(N2CCC(n3cnnc3)CC2)ccc1CN1SC(c2ccccc2)=CC=C1C(F)(F)F |
| InChI | InChI=1S/C25H23F4N5S/c26-22-14-21(32-12-10-20(11-13-32)33-16-30-31-17-33)7-6-19(22)15-34-24(25(27,28)29)9-8-23(35-34)18-4-2-1-3-5-18/h1-9,14,16-17,20H,10-13,15H2 |
| InChIKey | UEDDDAWTZSTZTI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|