C26H29F2N5O2S — CID 123722243
3-ethenyl-2-[[2-fluoro-4-[3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane 1,1-dioxide (PubChem CID 123722243) has the molecular formula C26H29F2N5O2S and a molecular weight of 513.61 g/mol. Its IUPAC name is 3-ethenyl-2-[[2-fluoro-4-[3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane 1,1-dioxide.
| Compound Name | 3-ethenyl-2-[[2-fluoro-4-[3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 123722243 |
| Molecular Formula | C26H29F2N5O2S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 3-ethenyl-2-[[2-fluoro-4-[3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane 1,1-dioxide |
| SMILES | C=CC1CCC(c2ccccc2)S(=O)(=O)N1Cc1ccc(N2CCC(n3cnnc3)C(F)C2)cc1F |
| InChI | InChI=1S/C26H29F2N5O2S/c1-2-21-10-11-26(19-6-4-3-5-7-19)36(34,35)33(21)15-20-8-9-22(14-23(20)27)31-13-12-25(24(28)16-31)32-17-29-30-18-32/h2-9,14,17-18,21,24-26H,1,10-13,15-16H2 |
| InChIKey | YWQHEHONDAPRQQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|