C25H28F3N5S — CID 118227362
(3R,6S)-3-(difluoromethyl)-2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane (PubChem CID 118227362) has the molecular formula C25H28F3N5S and a molecular weight of 487.60 g/mol. Its IUPAC name is (3R,6S)-3-(difluoromethyl)-2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane.
| Compound Name | (3R,6S)-3-(difluoromethyl)-2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane |
|---|---|
| PubChem CID | 118227362 |
| Molecular Formula | C25H28F3N5S |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (3R,6S)-3-(difluoromethyl)-2-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenylthiazinane |
| SMILES | Fc1cc(N2CCC(n3cnnc3)CC2)ccc1CN1S[C@H](c2ccccc2)CC[C@@H]1C(F)F |
| InChI | InChI=1S/C25H28F3N5S/c26-22-14-21(31-12-10-20(11-13-31)32-16-29-30-17-32)7-6-19(22)15-33-23(25(27)28)8-9-24(34-33)18-4-2-1-3-5-18/h1-7,14,16-17,20,23-25H,8-13,15H2/t23-,24+/m1/s1 |
| InChIKey | ZTDMLLFSDYHMEP-RPWUZVMVSA-N |
| XLogP | 5.88 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|