C26H30FN5S — CID 122684335
(6R)-4-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-5-thia-4-azaspiro[2.5]octane (PubChem CID 122684335) has the molecular formula C26H30FN5S and a molecular weight of 463.63 g/mol. Its IUPAC name is (6R)-4-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-5-thia-4-azaspiro[2.5]octane.
| Compound Name | (6R)-4-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-5-thia-4-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 122684335 |
| Molecular Formula | C26H30FN5S |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | (6R)-4-[[2-fluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-5-thia-4-azaspiro[2.5]octane |
| SMILES | Fc1cc(N2CCC(n3cnnc3)CC2)ccc1CN1S[C@@H](c2ccccc2)CCC12CC2 |
| InChI | InChI=1S/C26H30FN5S/c27-24-16-23(30-14-9-22(10-15-30)31-18-28-29-19-31)7-6-21(24)17-32-26(12-13-26)11-8-25(33-32)20-4-2-1-3-5-20/h1-7,16,18-19,22,25H,8-15,17H2/t25-/m1/s1 |
| InChIKey | PZNLSDBUDAFGGG-RUZDIDTESA-N |
| XLogP | 5.78 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|