C21H22FN3O2S — CID 174848521
2-[(2-fluoro-4-piperazin-1-ylphenyl)methyl]-6-phenylthiazine 1,1-dioxide (PubChem CID 174848521) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[(2-fluoro-4-piperazin-1-ylphenyl)methyl]-6-phenylthiazine 1,1-dioxide.
| Compound Name | 2-[(2-fluoro-4-piperazin-1-ylphenyl)methyl]-6-phenylthiazine 1,1-dioxide |
|---|---|
| PubChem CID | 174848521 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[(2-fluoro-4-piperazin-1-ylphenyl)methyl]-6-phenylthiazine 1,1-dioxide |
| SMILES | O=S1(=O)C(c2ccccc2)=CC=CN1Cc1ccc(N2CCNCC2)cc1F |
| InChI | InChI=1S/C21H22FN3O2S/c22-20-15-19(24-13-10-23-11-14-24)9-8-18(20)16-25-12-4-7-21(28(25,26)27)17-5-2-1-3-6-17/h1-9,12,15,23H,10-11,13-14,16H2 |
| InChIKey | BNTPOOXUUVVJPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |