About 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol
2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol (PubChem CID 139546200) has the molecular formula C18H23N5O2
and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol |
| PubChem CID | 139546200 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1CCC2(CC1)CNCCO2 |
| InChI | InChI=1S/C18H23N5O2/c19-17-15(11-14(21-22-17)13-3-1-2-4-16(13)24)23-8-5-18(6-9-23)12-20-7-10-25-18/h1-4,11,20,24H,5-10,12H2,(H2,19,22) |
| InChIKey | RHJYQYGDBYZFBN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol?
The IUPAC name of 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol (CID 139546200) is 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol.
What is the SMILES notation for 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol?
The canonical SMILES for 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol is Nc1nnc(-c2ccccc2O)cc1N1CCC2(CC1)CNCCO2.
What is the InChIKey of 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol?
The InChIKey is RHJYQYGDBYZFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O2/c19-17-15(11-14(21-22-17)13-3-1-2-4-16(13)24)23-8-5-18(6-9-23)12-20-7-10-25-18/h1-4,11,20,24H,5-10,12H2,(H2,19,22).
What are the key properties of 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol?
2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol has a molecular weight of 341.42 g/mol, XLogP of 1.39, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-5-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)pyridazin-3-yl]phenol is sourced from PubChem (CID 139546200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).