C24H27ClN2O5S2 — CID 139550791
4-tert-butyl-N-[4-(4-chloro-3-methoxyphenoxy)-5-(4-oxobutyl)-1,2-thiazol-3-yl]benzenesulfonamide (PubChem CID 139550791) has the molecular formula C24H27ClN2O5S2 and a molecular weight of 523.08 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(4-chloro-3-methoxyphenoxy)-5-(4-oxobutyl)-1,2-thiazol-3-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-(4-chloro-3-methoxyphenoxy)-5-(4-oxobutyl)-1,2-thiazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 139550791 |
| Molecular Formula | C24H27ClN2O5S2 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 4-tert-butyl-N-[4-(4-chloro-3-methoxyphenoxy)-5-(4-oxobutyl)-1,2-thiazol-3-yl]benzenesulfonamide |
| SMILES | COc1cc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nsc2CCCC=O)ccc1Cl |
| InChI | InChI=1S/C24H27ClN2O5S2/c1-24(2,3)16-8-11-18(12-9-16)34(29,30)27-23-22(21(33-26-23)7-5-6-14-28)32-17-10-13-19(25)20(15-17)31-4/h8-15H,5-7H2,1-4H3,(H,26,27) |
| InChIKey | AKLBXGQUIHOCQS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|