C26H28ClN3O5S — CID 139550832
4-tert-butyl-N-[2-chloro-5-(3-methoxyphenoxy)-6-pent-4-ynoxypyrimidin-4-yl]benzenesulfonamide (PubChem CID 139550832) has the molecular formula C26H28ClN3O5S and a molecular weight of 530.05 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-chloro-5-(3-methoxyphenoxy)-6-pent-4-ynoxypyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-chloro-5-(3-methoxyphenoxy)-6-pent-4-ynoxypyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 139550832 |
| Molecular Formula | C26H28ClN3O5S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 4-tert-butyl-N-[2-chloro-5-(3-methoxyphenoxy)-6-pent-4-ynoxypyrimidin-4-yl]benzenesulfonamide |
| SMILES | C#CCCCOc1nc(Cl)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1cccc(OC)c1 |
| InChI | InChI=1S/C26H28ClN3O5S/c1-6-7-8-16-34-24-22(35-20-11-9-10-19(17-20)33-5)23(28-25(27)29-24)30-36(31,32)21-14-12-18(13-15-21)26(2,3)4/h1,9-15,17H,7-8,16H2,2-5H3,(H,28,29,30) |
| InChIKey | YUMSRGLTFDGGGY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|