C26H29N3O10S — CID 70142022
2-[6-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyoxy-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxyethyl acetate (PubChem CID 70142022) has the molecular formula C26H29N3O10S and a molecular weight of 575.60 g/mol. Its IUPAC name is 2-[6-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyoxy-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxyethyl acetate.
| Compound Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyoxy-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxyethyl acetate |
|---|---|
| PubChem CID | 70142022 |
| Molecular Formula | C26H29N3O10S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyoxy-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxyethyl acetate |
| SMILES | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(OC(=O)O)nc2OCCOC(C)=O)c1 |
| InChI | InChI=1S/C26H29N3O10S/c1-16(30)36-13-14-37-23-21(38-19-8-6-7-18(15-19)35-5)22(27-24(28-23)39-25(31)32)29-40(33,34)20-11-9-17(10-12-20)26(2,3)4/h6-12,15H,13-14H2,1-5H3,(H,31,32)(H,27,28,29) |
| InChIKey | BVWINQMGUOGCEY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|