C26H30N4O9S — CID 57025505
2-[[6-[(4-tert-butylphenyl)sulfonylamino]-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxy-ethoxycarbonylamino]acetic acid (PubChem CID 57025505) has the molecular formula C26H30N4O9S and a molecular weight of 574.61 g/mol. Its IUPAC name is 2-[[6-[(4-tert-butylphenyl)sulfonylamino]-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxy-ethoxycarbonylamino]acetic acid.
| Compound Name | 2-[[6-[(4-tert-butylphenyl)sulfonylamino]-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxy-ethoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 57025505 |
| Molecular Formula | C26H30N4O9S |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[[6-[(4-tert-butylphenyl)sulfonylamino]-5-(3-methoxyphenoxy)pyrimidin-4-yl]oxy-ethoxycarbonylamino]acetic acid |
| SMILES | CCOC(=O)N(CC(=O)O)Oc1ncnc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1cccc(OC)c1 |
| InChI | InChI=1S/C26H30N4O9S/c1-6-37-25(33)30(15-21(31)32)39-24-22(38-19-9-7-8-18(14-19)36-5)23(27-16-28-24)29-40(34,35)20-12-10-17(11-13-20)26(2,3)4/h7-14,16H,6,15H2,1-5H3,(H,31,32)(H,27,28,29) |
| InChIKey | UMXXVCMEYNOIRJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 166.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|