C52H42F6N2S2 — CID 139553126
10-[2,5-ditert-butyl-3-phenothiazin-10-yl-4,6-bis[3-(trifluoromethyl)phenyl]phenyl]phenothiazine (PubChem CID 139553126) has the molecular formula C52H42F6N2S2 and a molecular weight of 873.04 g/mol. Its IUPAC name is 10-[2,5-ditert-butyl-3-phenothiazin-10-yl-4,6-bis[3-(trifluoromethyl)phenyl]phenyl]phenothiazine.
| Compound Name | 10-[2,5-ditert-butyl-3-phenothiazin-10-yl-4,6-bis[3-(trifluoromethyl)phenyl]phenyl]phenothiazine |
|---|---|
| PubChem CID | 139553126 |
| Molecular Formula | C52H42F6N2S2 |
| Molecular Weight | 873.04 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | 10-[2,5-ditert-butyl-3-phenothiazin-10-yl-4,6-bis[3-(trifluoromethyl)phenyl]phenyl]phenothiazine |
| SMILES | CC(C)(C)c1c(-c2cccc(C(F)(F)F)c2)c(N2c3ccccc3Sc3ccccc32)c(C(C)(C)C)c(N2c3ccccc3Sc3ccccc32)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C52H42F6N2S2/c1-49(2,3)45-43(31-17-15-19-33(29-31)51(53,54)55)47(59-35-21-7-11-25-39(35)61-40-26-12-8-22-36(40)59)46(50(4,5)6)48(44(45)32-18-16-20-34(30-32)52(56,57)58)60-37-23-9-13-27-41(37)62-42-28-14-10-24-38(42)60/h7-30H,1-6H3 |
| InChIKey | JVWDZGPWOHBPDJ-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.04 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |