C47H32F6N2S2 — CID 139553554
10-[3-phenothiazin-10-yl-2-propan-2-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenothiazine (PubChem CID 139553554) has the molecular formula C47H32F6N2S2 and a molecular weight of 802.91 g/mol. Its IUPAC name is 10-[3-phenothiazin-10-yl-2-propan-2-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenothiazine.
| Compound Name | 10-[3-phenothiazin-10-yl-2-propan-2-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenothiazine |
|---|---|
| PubChem CID | 139553554 |
| Molecular Formula | C47H32F6N2S2 |
| Molecular Weight | 802.91 g/mol |
| Exact Mass | 802.19 |
| IUPAC Name | 10-[3-phenothiazin-10-yl-2-propan-2-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenothiazine |
| SMILES | CC(C)c1c(N2c3ccccc3Sc3ccccc32)c(-c2ccc(C(F)(F)F)cc2)cc(-c2ccc(C(F)(F)F)cc2)c1N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C47H32F6N2S2/c1-28(2)43-44(54-35-11-3-7-15-39(35)56-40-16-8-4-12-36(40)54)33(29-19-23-31(24-20-29)46(48,49)50)27-34(30-21-25-32(26-22-30)47(51,52)53)45(43)55-37-13-5-9-17-41(37)57-42-18-10-6-14-38(42)55/h3-28H,1-2H3 |
| InChIKey | VUYOSEZJVWDGEA-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.91 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |