C48H34F6N2OS — CID 139553546
10-[2,5-diethyl-3-phenothiazin-10-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenoxazine (PubChem CID 139553546) has the molecular formula C48H34F6N2OS and a molecular weight of 800.87 g/mol. Its IUPAC name is 10-[2,5-diethyl-3-phenothiazin-10-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenoxazine.
| Compound Name | 10-[2,5-diethyl-3-phenothiazin-10-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 139553546 |
| Molecular Formula | C48H34F6N2OS |
| Molecular Weight | 800.87 g/mol |
| Exact Mass | 800.23 |
| IUPAC Name | 10-[2,5-diethyl-3-phenothiazin-10-yl-4,6-bis[4-(trifluoromethyl)phenyl]phenyl]phenoxazine |
| SMILES | CCc1c(-c2ccc(C(F)(F)F)cc2)c(N2c3ccccc3Oc3ccccc32)c(CC)c(N2c3ccccc3Sc3ccccc32)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C48H34F6N2OS/c1-3-33-43(29-21-25-31(26-22-29)47(49,50)51)45(55-35-13-5-9-17-39(35)57-40-18-10-6-14-36(40)55)34(4-2)46(44(33)30-23-27-32(28-24-30)48(52,53)54)56-37-15-7-11-19-41(37)58-42-20-12-8-16-38(42)56/h5-28H,3-4H2,1-2H3 |
| InChIKey | IFKCPQFMTGGJPB-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.87 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |