C24H38N2O7 — CID 139562896
[(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate (PubChem CID 139562896) has the molecular formula C24H38N2O7 and a molecular weight of 466.58 g/mol. Its IUPAC name is [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate.
| Compound Name | [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 139562896 |
| Molecular Formula | C24H38N2O7 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
| SMILES | C=N/C(C(=O)N[C@@H](C)C(=O)O[C@@H](C)[C@@H](CC(C)C)OCC1CC1)=C(OC(C)=O)\C(=C/C)OC |
| InChI | InChI=1S/C24H38N2O7/c1-9-19(30-8)22(33-17(6)27)21(25-7)23(28)26-15(4)24(29)32-16(5)20(12-14(2)3)31-13-18-10-11-18/h9,14-16,18,20H,7,10-13H2,1-6,8H3,(H,26,28)/b19-9+,22-21+/t15-,16-,20+/m0/s1 |
| InChIKey | YBEZQWVDPLMWRA-WHXHGDMTSA-N |
| XLogP | 3.29 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|