C27H37FN2O7 — CID 138507541
[(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-[[(2E,4E)-3-(acetyloxymethoxy)-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate (PubChem CID 138507541) has the molecular formula C27H37FN2O7 and a molecular weight of 520.60 g/mol. Its IUPAC name is [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-[[(2E,4E)-3-(acetyloxymethoxy)-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate.
| Compound Name | [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-[[(2E,4E)-3-(acetyloxymethoxy)-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 138507541 |
| Molecular Formula | C27H37FN2O7 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-[[(2E,4E)-3-(acetyloxymethoxy)-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
| SMILES | C=N/C(C(=O)N[C@@H](C)C(=O)O[C@@H](C)[C@H](c1ccc(F)cc1C)C(C)C)=C(OCOC(C)=O)\C(=C/C)OC |
| InChI | InChI=1S/C27H37FN2O7/c1-10-22(34-9)25(36-14-35-19(7)31)24(29-8)26(32)30-17(5)27(33)37-18(6)23(15(2)3)21-12-11-20(28)13-16(21)4/h10-13,15,17-18,23H,8,14H2,1-7,9H3,(H,30,32)/b22-10+,25-24+/t17-,18-,23+/m0/s1 |
| InChIKey | OIVDHTNBTCKTDS-IAXXLASKSA-N |
| XLogP | 4.31 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|